C11H15FN2O3S — CID 65375543
N,N-diethyl-3-fluoro-5-sulfamoylbenzamide (PubChem CID 65375543) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is N,N-diethyl-3-fluoro-5-sulfamoylbenzamide.
| Compound Name | N,N-diethyl-3-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375543 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N,N-diethyl-3-fluoro-5-sulfamoylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H15FN2O3S/c1-3-14(4-2)11(15)8-5-9(12)7-10(6-8)18(13,16)17/h5-7H,3-4H2,1-2H3,(H2,13,16,17) |
| InChIKey | VIBYHLNVCJQJLB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |