C12H17FN2O3S — CID 65375754
3-fluoro-N-pentyl-5-sulfamoylbenzamide (PubChem CID 65375754) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is 3-fluoro-N-pentyl-5-sulfamoylbenzamide.
| Compound Name | 3-fluoro-N-pentyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375754 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-fluoro-N-pentyl-5-sulfamoylbenzamide |
| SMILES | CCCCCNC(=O)c1cc(F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H17FN2O3S/c1-2-3-4-5-15-12(16)9-6-10(13)8-11(7-9)19(14,17)18/h6-8H,2-5H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | PBMKVAHQIYZTGY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|