C10H12F2N2O3S — CID 65375226
N-ethyl-2,4-difluoro-N-methyl-5-sulfamoylbenzamide (PubChem CID 65375226) has the molecular formula C10H12F2N2O3S and a molecular weight of 278.28 g/mol. Its IUPAC name is N-ethyl-2,4-difluoro-N-methyl-5-sulfamoylbenzamide.
| Compound Name | N-ethyl-2,4-difluoro-N-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375226 |
| Molecular Formula | C10H12F2N2O3S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-ethyl-2,4-difluoro-N-methyl-5-sulfamoylbenzamide |
| SMILES | CCN(C)C(=O)c1cc(S(N)(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C10H12F2N2O3S/c1-3-14(2)10(15)6-4-9(18(13,16)17)8(12)5-7(6)11/h4-5H,3H2,1-2H3,(H2,13,16,17) |
| InChIKey | QFYGNOUTXMVSDJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |