C11H14F2N2O3S — CID 65375638
N-tert-butyl-2,4-difluoro-5-sulfamoylbenzamide (PubChem CID 65375638) has the molecular formula C11H14F2N2O3S and a molecular weight of 292.31 g/mol. Its IUPAC name is N-tert-butyl-2,4-difluoro-5-sulfamoylbenzamide.
| Compound Name | N-tert-butyl-2,4-difluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375638 |
| Molecular Formula | C11H14F2N2O3S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-tert-butyl-2,4-difluoro-5-sulfamoylbenzamide |
| SMILES | CC(C)(C)NC(=O)c1cc(S(N)(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C11H14F2N2O3S/c1-11(2,3)15-10(16)6-4-9(19(14,17)18)8(13)5-7(6)12/h4-5H,1-3H3,(H,15,16)(H2,14,17,18) |
| InChIKey | RJQTUEVQANTCJL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |