C11H13ClFNO3S — CID 65372366
3-(tert-butylcarbamoyl)-4-fluorobenzenesulfonyl chloride (PubChem CID 65372366) has the molecular formula C11H13ClFNO3S and a molecular weight of 293.75 g/mol. Its IUPAC name is 3-(tert-butylcarbamoyl)-4-fluorobenzenesulfonyl chloride.
| Compound Name | 3-(tert-butylcarbamoyl)-4-fluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65372366 |
| Molecular Formula | C11H13ClFNO3S |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-(tert-butylcarbamoyl)-4-fluorobenzenesulfonyl chloride |
| SMILES | CC(C)(C)NC(=O)c1cc(S(=O)(=O)Cl)ccc1F |
| InChI | InChI=1S/C11H13ClFNO3S/c1-11(2,3)14-10(15)8-6-7(18(12,16)17)4-5-9(8)13/h4-6H,1-3H3,(H,14,15) |
| InChIKey | JHKUVUOUJYKPFK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |