C9H9ClFNO3S — CID 65367572
3-(ethylcarbamoyl)-4-fluorobenzenesulfonyl chloride (PubChem CID 65367572) has the molecular formula C9H9ClFNO3S and a molecular weight of 265.69 g/mol. Its IUPAC name is 3-(ethylcarbamoyl)-4-fluorobenzenesulfonyl chloride.
| Compound Name | 3-(ethylcarbamoyl)-4-fluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65367572 |
| Molecular Formula | C9H9ClFNO3S |
| Molecular Weight | 265.69 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 3-(ethylcarbamoyl)-4-fluorobenzenesulfonyl chloride |
| SMILES | CCNC(=O)c1cc(S(=O)(=O)Cl)ccc1F |
| InChI | InChI=1S/C9H9ClFNO3S/c1-2-12-9(13)7-5-6(16(10,14)15)3-4-8(7)11/h3-5H,2H2,1H3,(H,12,13) |
| InChIKey | NFLRSDZKTCAZLP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |