C9H7Cl2F2NO3S — CID 65367815
2-chloro-3-(ethylcarbamoyl)-5,6-difluorobenzenesulfonyl chloride (PubChem CID 65367815) has the molecular formula C9H7Cl2F2NO3S and a molecular weight of 318.13 g/mol. Its IUPAC name is 2-chloro-3-(ethylcarbamoyl)-5,6-difluorobenzenesulfonyl chloride.
| Compound Name | 2-chloro-3-(ethylcarbamoyl)-5,6-difluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65367815 |
| Molecular Formula | C9H7Cl2F2NO3S |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 2-chloro-3-(ethylcarbamoyl)-5,6-difluorobenzenesulfonyl chloride |
| SMILES | CCNC(=O)c1cc(F)c(F)c(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl2F2NO3S/c1-2-14-9(15)4-3-5(12)7(13)8(6(4)10)18(11,16)17/h3H,2H2,1H3,(H,14,15) |
| InChIKey | FTZCTTCBNVNOCS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|