C10H8Cl3FO4S — CID 65396721
propyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate (PubChem CID 65396721) has the molecular formula C10H8Cl3FO4S and a molecular weight of 349.59 g/mol. Its IUPAC name is propyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate.
| Compound Name | propyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate |
|---|---|
| PubChem CID | 65396721 |
| Molecular Formula | C10H8Cl3FO4S |
| Molecular Weight | 349.59 g/mol |
| Exact Mass | 347.92 |
| IUPAC Name | propyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate |
| SMILES | CCCOC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C10H8Cl3FO4S/c1-2-3-18-10(15)5-4-6(14)8(12)9(7(5)11)19(13,16)17/h4H,2-3H2,1H3 |
| InChIKey | WSYLZPNVQBZTRV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|