C11H12Cl2FNO4S — CID 65380219
tert-butyl 2,4-dichloro-5-fluoro-3-sulfamoylbenzoate (PubChem CID 65380219) has the molecular formula C11H12Cl2FNO4S and a molecular weight of 344.19 g/mol. Its IUPAC name is tert-butyl 2,4-dichloro-5-fluoro-3-sulfamoylbenzoate.
| Compound Name | tert-butyl 2,4-dichloro-5-fluoro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 65380219 |
| Molecular Formula | C11H12Cl2FNO4S |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | tert-butyl 2,4-dichloro-5-fluoro-3-sulfamoylbenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(F)c(Cl)c(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C11H12Cl2FNO4S/c1-11(2,3)19-10(16)5-4-6(14)8(13)9(7(5)12)20(15,17)18/h4H,1-3H3,(H2,15,17,18) |
| InChIKey | KLMMCUYSMAWRBW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|