C12H12Cl3FO4S — CID 65373326
3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate (PubChem CID 65373326) has the molecular formula C12H12Cl3FO4S and a molecular weight of 377.65 g/mol. Its IUPAC name is 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate.
| Compound Name | 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate |
|---|---|
| PubChem CID | 65373326 |
| Molecular Formula | C12H12Cl3FO4S |
| Molecular Weight | 377.65 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate |
| SMILES | CC(C)CCOC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl3FO4S/c1-6(2)3-4-20-12(17)7-5-8(16)10(14)11(9(7)13)21(15,18)19/h5-6H,3-4H2,1-2H3 |
| InChIKey | YWOLSFPSNORIAL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|