3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate

C12H12Cl3FO4S — CID 65373326

IUPAC3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate
SMILESCC(C)CCOC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl
InChIInChI=1S/C12H12Cl3FO4S/c1-6(2)3-4-20-12(17)7-5-8(16)10(14)11(9(7)13)21(15,18)19/h5-6H,3-4H2,1-2H3
InChIKeyYWOLSFPSNORIAL-UHFFFAOYSA-N
MW377.65 g/mol
LogP4.26
Rot. Bonds5

About 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate

3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate (PubChem CID 65373326) has the molecular formula C12H12Cl3FO4S and a molecular weight of 377.65 g/mol. Its IUPAC name is 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate.

Molecular Properties

Compound Name3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate
PubChem CID65373326
Molecular FormulaC12H12Cl3FO4S
Molecular Weight377.65 g/mol
Exact Mass375.95
IUPAC Name3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate
SMILESCC(C)CCOC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl
InChIInChI=1S/C12H12Cl3FO4S/c1-6(2)3-4-20-12(17)7-5-8(16)10(14)11(9(7)13)21(15,18)19/h5-6H,3-4H2,1-2H3
InChIKeyYWOLSFPSNORIAL-UHFFFAOYSA-N
XLogP4.26
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500377.65
LogP ≤ 54.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate?
The IUPAC name of 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate (CID 65373326) is 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate.
What is the SMILES notation for 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate?
The canonical SMILES for 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate is CC(C)CCOC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl.
What is the InChIKey of 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate?
The InChIKey is YWOLSFPSNORIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl3FO4S/c1-6(2)3-4-20-12(17)7-5-8(16)10(14)11(9(7)13)21(15,18)19/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate?
3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate has a molecular weight of 377.65 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 2,4-dichloro-3-chlorosulfonyl-5-fluorobenzoate is sourced from PubChem (CID 65373326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).