3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride

C7H3Cl3FNO3S — CID 65367638

IUPAC3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride
SMILESNC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl
InChIInChI=1S/C7H3Cl3FNO3S/c8-4-2(7(12)13)1-3(11)5(9)6(4)16(10,14)15/h1H,(H2,12,13)
InChIKeyGNRQULQQQXLSGW-UHFFFAOYSA-N
MW306.53 g/mol
LogP2.16
Rot. Bonds2

About 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride

3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride (PubChem CID 65367638) has the molecular formula C7H3Cl3FNO3S and a molecular weight of 306.53 g/mol. Its IUPAC name is 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride.

Molecular Properties

Compound Name3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride
PubChem CID65367638
Molecular FormulaC7H3Cl3FNO3S
Molecular Weight306.53 g/mol
Exact Mass304.89
IUPAC Name3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride
SMILESNC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl
InChIInChI=1S/C7H3Cl3FNO3S/c8-4-2(7(12)13)1-3(11)5(9)6(4)16(10,14)15/h1H,(H2,12,13)
InChIKeyGNRQULQQQXLSGW-UHFFFAOYSA-N
XLogP2.16
TPSA77.23 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.53
LogP ≤ 52.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride?
The IUPAC name of 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride (CID 65367638) is 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride.
What is the SMILES notation for 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride?
The canonical SMILES for 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride is NC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl.
What is the InChIKey of 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride?
The InChIKey is GNRQULQQQXLSGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl3FNO3S/c8-4-2(7(12)13)1-3(11)5(9)6(4)16(10,14)15/h1H,(H2,12,13).
What are the key properties of 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride?
3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride has a molecular weight of 306.53 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride is sourced from PubChem (CID 65367638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).