C7H3Cl3FNO3S — CID 65367638
3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride (PubChem CID 65367638) has the molecular formula C7H3Cl3FNO3S and a molecular weight of 306.53 g/mol. Its IUPAC name is 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride.
| Compound Name | 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65367638 |
| Molecular Formula | C7H3Cl3FNO3S |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 304.89 |
| IUPAC Name | 3-carbamoyl-2,6-dichloro-5-fluorobenzenesulfonyl chloride |
| SMILES | NC(=O)c1cc(F)c(Cl)c(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl3FNO3S/c8-4-2(7(12)13)1-3(11)5(9)6(4)16(10,14)15/h1H,(H2,12,13) |
| InChIKey | GNRQULQQQXLSGW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|