C7H5F2NO4S — CID 157144700
2-carbamoyl-4,5-difluorobenzenesulfonic acid (PubChem CID 157144700) has the molecular formula C7H5F2NO4S and a molecular weight of 237.18 g/mol. Its IUPAC name is 2-carbamoyl-4,5-difluorobenzenesulfonic acid.
| Compound Name | 2-carbamoyl-4,5-difluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 157144700 |
| Molecular Formula | C7H5F2NO4S |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 2-carbamoyl-4,5-difluorobenzenesulfonic acid |
| SMILES | NC(=O)c1cc(F)c(F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C7H5F2NO4S/c8-4-1-3(7(10)11)6(2-5(4)9)15(12,13)14/h1-2H,(H2,10,11)(H,12,13,14) |
| InChIKey | UEYWHPVSWBWENX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|