C7H4BrF2NO — CID 53418047
4-bromo-2,5-difluorobenzamide (PubChem CID 53418047) has the molecular formula C7H4BrF2NO and a molecular weight of 236.01 g/mol. Its IUPAC name is 4-bromo-2,5-difluorobenzamide.
| Compound Name | 4-bromo-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 53418047 |
| Molecular Formula | C7H4BrF2NO |
| Molecular Weight | 236.01 g/mol |
| Exact Mass | 234.94 |
| IUPAC Name | 4-bromo-2,5-difluorobenzamide |
| SMILES | NC(=O)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C7H4BrF2NO/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H,(H2,11,12) |
| InChIKey | QEXQXWQSPGXPDH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.01 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|