C7H7Cl2F2NO — CID 22032026
2,4-difluorobenzamide;dihydrochloride (PubChem CID 22032026) has the molecular formula C7H7Cl2F2NO and a molecular weight of 230.04 g/mol. Its IUPAC name is 2,4-difluorobenzamide;dihydrochloride.
| Compound Name | 2,4-difluorobenzamide;dihydrochloride |
|---|---|
| PubChem CID | 22032026 |
| Molecular Formula | C7H7Cl2F2NO |
| Molecular Weight | 230.04 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 2,4-difluorobenzamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C7H5F2NO.2ClH/c8-4-1-2-5(7(10)11)6(9)3-4;;/h1-3H,(H2,10,11);2*1H |
| InChIKey | IKDRNWOLVHPEET-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.04 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |