C9H7F2NO3 — CID 18700465
2-amino-3-(2,4-difluorophenyl)-3-oxopropanoic acid (PubChem CID 18700465) has the molecular formula C9H7F2NO3 and a molecular weight of 215.16 g/mol. Its IUPAC name is 2-amino-3-(2,4-difluorophenyl)-3-oxopropanoic acid.
| Compound Name | 2-amino-3-(2,4-difluorophenyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 18700465 |
| Molecular Formula | C9H7F2NO3 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-amino-3-(2,4-difluorophenyl)-3-oxopropanoic acid |
| SMILES | NC(C(=O)O)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H7F2NO3/c10-4-1-2-5(6(11)3-4)8(13)7(12)9(14)15/h1-3,7H,12H2,(H,14,15) |
| InChIKey | AUQMZJHCCVBOMK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|