C9H7BrF2O — CID 9106630
(2S)-2-bromo-1-(2,4-difluorophenyl)propan-1-one (PubChem CID 9106630) has the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. Its IUPAC name is (2S)-2-bromo-1-(2,4-difluorophenyl)propan-1-one.
| Compound Name | (2S)-2-bromo-1-(2,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 9106630 |
| Molecular Formula | C9H7BrF2O |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | (2S)-2-bromo-1-(2,4-difluorophenyl)propan-1-one |
| SMILES | C[C@H](Br)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H7BrF2O/c1-5(10)9(13)7-3-2-6(11)4-8(7)12/h2-5H,1H3/t5-/m0/s1 |
| InChIKey | GOLMFRUVGNQYAV-YFKPBYRVSA-N |
| XLogP | 2.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|