C11H12BrFO3 — CID 62866207
2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)propan-1-one (PubChem CID 62866207) has the molecular formula C11H12BrFO3 and a molecular weight of 291.12 g/mol. Its IUPAC name is 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)propan-1-one.
| Compound Name | 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 62866207 |
| Molecular Formula | C11H12BrFO3 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2-bromo-1-(2-fluoro-4,5-dimethoxyphenyl)propan-1-one |
| SMILES | COc1cc(F)c(C(=O)C(C)Br)cc1OC |
| InChI | InChI=1S/C11H12BrFO3/c1-6(12)11(14)7-4-9(15-2)10(16-3)5-8(7)13/h4-6H,1-3H3 |
| InChIKey | HOTCPJKCBWBTAH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|