C14H17FO5 — CID 62935002
5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid (PubChem CID 62935002) has the molecular formula C14H17FO5 and a molecular weight of 284.28 g/mol. Its IUPAC name is 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62935002 |
| Molecular Formula | C14H17FO5 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid |
| SMILES | COc1cc(F)c(C(=O)CC(C)CC(=O)O)cc1OC |
| InChI | InChI=1S/C14H17FO5/c1-8(5-14(17)18)4-11(16)9-6-12(19-2)13(20-3)7-10(9)15/h6-8H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | JKNJYNBGXQMJAS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |