5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid

C14H17FO5 — CID 62935002

IUPAC5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid
SMILESCOc1cc(F)c(C(=O)CC(C)CC(=O)O)cc1OC
InChIInChI=1S/C14H17FO5/c1-8(5-14(17)18)4-11(16)9-6-12(19-2)13(20-3)7-10(9)15/h6-8H,4-5H2,1-3H3,(H,17,18)
InChIKeyJKNJYNBGXQMJAS-UHFFFAOYSA-N
MW284.28 g/mol
LogP2.53
Rot. Bonds7

About 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid

5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid (PubChem CID 62935002) has the molecular formula C14H17FO5 and a molecular weight of 284.28 g/mol. Its IUPAC name is 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid.

Molecular Properties

Compound Name5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid
PubChem CID62935002
Molecular FormulaC14H17FO5
Molecular Weight284.28 g/mol
Exact Mass284.11
IUPAC Name5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid
SMILESCOc1cc(F)c(C(=O)CC(C)CC(=O)O)cc1OC
InChIInChI=1S/C14H17FO5/c1-8(5-14(17)18)4-11(16)9-6-12(19-2)13(20-3)7-10(9)15/h6-8H,4-5H2,1-3H3,(H,17,18)
InChIKeyJKNJYNBGXQMJAS-UHFFFAOYSA-N
XLogP2.53
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.28
LogP ≤ 52.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid?
The IUPAC name of 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid (CID 62935002) is 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid.
What is the SMILES notation for 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid?
The canonical SMILES for 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid is COc1cc(F)c(C(=O)CC(C)CC(=O)O)cc1OC.
What is the InChIKey of 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid?
The InChIKey is JKNJYNBGXQMJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FO5/c1-8(5-14(17)18)4-11(16)9-6-12(19-2)13(20-3)7-10(9)15/h6-8H,4-5H2,1-3H3,(H,17,18).
What are the key properties of 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid?
5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid has a molecular weight of 284.28 g/mol, XLogP of 2.53, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoro-4,5-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid is sourced from PubChem (CID 62935002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).