C16H15FO3 — CID 62866029
1-(2-fluoro-4,5-dimethoxyphenyl)-2-phenylethanone (PubChem CID 62866029) has the molecular formula C16H15FO3 and a molecular weight of 274.29 g/mol. Its IUPAC name is 1-(2-fluoro-4,5-dimethoxyphenyl)-2-phenylethanone.
| Compound Name | 1-(2-fluoro-4,5-dimethoxyphenyl)-2-phenylethanone |
|---|---|
| PubChem CID | 62866029 |
| Molecular Formula | C16H15FO3 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2-fluoro-4,5-dimethoxyphenyl)-2-phenylethanone |
| SMILES | COc1cc(F)c(C(=O)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C16H15FO3/c1-19-15-9-12(13(17)10-16(15)20-2)14(18)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | OCBZEAZVKQEHMF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |