C10H9ClF2O — CID 130136877
2-chloro-1-(2,4-difluorophenyl)butan-1-one (PubChem CID 130136877) has the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. Its IUPAC name is 2-chloro-1-(2,4-difluorophenyl)butan-1-one.
| Compound Name | 2-chloro-1-(2,4-difluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 130136877 |
| Molecular Formula | C10H9ClF2O |
| Molecular Weight | 218.63 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-chloro-1-(2,4-difluorophenyl)butan-1-one |
| SMILES | CCC(Cl)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H9ClF2O/c1-2-8(11)10(14)7-4-3-6(12)5-9(7)13/h3-5,8H,2H2,1H3 |
| InChIKey | GCBPRBMQKJIMAO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|