C10H10F2 — CID 57095622
1-but-1-en-2-yl-2,4-difluorobenzene (PubChem CID 57095622) has the molecular formula C10H10F2 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-but-1-en-2-yl-2,4-difluorobenzene.
| Compound Name | 1-but-1-en-2-yl-2,4-difluorobenzene |
|---|---|
| PubChem CID | 57095622 |
| Molecular Formula | C10H10F2 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-but-1-en-2-yl-2,4-difluorobenzene |
| SMILES | C=C(CC)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H10F2/c1-3-7(2)9-5-4-8(11)6-10(9)12/h4-6H,2-3H2,1H3 |
| InChIKey | ZYEFZRMXMBFTHV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |