C15H16F2O4 — CID 121307550
1-O-ethyl 3-O-methyl 2-[2-(2,4-difluorophenyl)prop-2-enyl]propanedioate (PubChem CID 121307550) has the molecular formula C15H16F2O4 and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl 2-[2-(2,4-difluorophenyl)prop-2-enyl]propanedioate.
| Compound Name | 1-O-ethyl 3-O-methyl 2-[2-(2,4-difluorophenyl)prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 121307550 |
| Molecular Formula | C15H16F2O4 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-O-ethyl 3-O-methyl 2-[2-(2,4-difluorophenyl)prop-2-enyl]propanedioate |
| SMILES | C=C(CC(C(=O)OC)C(=O)OCC)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H16F2O4/c1-4-21-15(19)12(14(18)20-3)7-9(2)11-6-5-10(16)8-13(11)17/h5-6,8,12H,2,4,7H2,1,3H3 |
| InChIKey | AQOMSHRSXYPFLO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|