C10H10F2O — CID 23289047
3-(2,4-difluorophenyl)but-3-en-2-ol (PubChem CID 23289047) has the molecular formula C10H10F2O and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)but-3-en-2-ol.
| Compound Name | 3-(2,4-difluorophenyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 23289047 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-(2,4-difluorophenyl)but-3-en-2-ol |
| SMILES | C=C(c1ccc(F)cc1F)C(C)O |
| InChI | InChI=1S/C10H10F2O/c1-6(7(2)13)9-4-3-8(11)5-10(9)12/h3-5,7,13H,1H2,2H3 |
| InChIKey | WEVQERZIZJDSDE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |