C7H5F2NS — CID 2781868
2,4-difluorobenzenecarbothioamide (PubChem CID 2781868) has the molecular formula C7H5F2NS and a molecular weight of 173.19 g/mol. Its IUPAC name is 2,4-difluorobenzenecarbothioamide.
| Compound Name | 2,4-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 2781868 |
| Molecular Formula | C7H5F2NS |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 2,4-difluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(F)cc1F |
| InChI | InChI=1S/C7H5F2NS/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H2,10,11) |
| InChIKey | MOHAZBCWHUCIEX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|