C13H8ClF2NOS — CID 62948650
2-chloro-4-(2,4-difluorophenoxy)benzenecarbothioamide (PubChem CID 62948650) has the molecular formula C13H8ClF2NOS and a molecular weight of 299.73 g/mol. Its IUPAC name is 2-chloro-4-(2,4-difluorophenoxy)benzenecarbothioamide.
| Compound Name | 2-chloro-4-(2,4-difluorophenoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 62948650 |
| Molecular Formula | C13H8ClF2NOS |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-chloro-4-(2,4-difluorophenoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Oc2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C13H8ClF2NOS/c14-10-6-8(2-3-9(10)13(17)19)18-12-4-1-7(15)5-11(12)16/h1-6H,(H2,17,19) |
| InChIKey | OSWXFXOOZBTTOE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|