C7H8F2IN3 — CID 86594416
N'-amino-2,4-difluorobenzenecarboximidamide;hydroiodide (PubChem CID 86594416) has the molecular formula C7H8F2IN3 and a molecular weight of 299.06 g/mol. Its IUPAC name is N'-amino-2,4-difluorobenzenecarboximidamide;hydroiodide.
| Compound Name | N'-amino-2,4-difluorobenzenecarboximidamide;hydroiodide |
|---|---|
| PubChem CID | 86594416 |
| Molecular Formula | C7H8F2IN3 |
| Molecular Weight | 299.06 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | N'-amino-2,4-difluorobenzenecarboximidamide;hydroiodide |
| SMILES | I.NN=C(N)c1ccc(F)cc1F |
| InChI | InChI=1S/C7H7F2N3.HI/c8-4-1-2-5(6(9)3-4)7(10)12-11;/h1-3H,11H2,(H2,10,12);1H |
| InChIKey | ZEJIASWDZOMIDS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.06 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|