C7H6ClF2N3 — CID 82771669
N'-amino-4-chloro-2,5-difluorobenzenecarboximidamide (PubChem CID 82771669) has the molecular formula C7H6ClF2N3 and a molecular weight of 205.60 g/mol. Its IUPAC name is N'-amino-4-chloro-2,5-difluorobenzenecarboximidamide.
| Compound Name | N'-amino-4-chloro-2,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 82771669 |
| Molecular Formula | C7H6ClF2N3 |
| Molecular Weight | 205.60 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | N'-amino-4-chloro-2,5-difluorobenzenecarboximidamide |
| SMILES | N/N=C(/N)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C7H6ClF2N3/c8-4-2-5(9)3(1-6(4)10)7(11)13-12/h1-2H,12H2,(H2,11,13) |
| InChIKey | JOXBCBWVFPXNCH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.60 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|