C10H9ClF2O — CID 164945789
1-(4-chloro-2,5-difluorophenyl)-2-methylprop-1-en-1-ol (PubChem CID 164945789) has the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-methylprop-1-en-1-ol.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-methylprop-1-en-1-ol |
|---|---|
| PubChem CID | 164945789 |
| Molecular Formula | C10H9ClF2O |
| Molecular Weight | 218.63 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-methylprop-1-en-1-ol |
| SMILES | CC(C)=C(O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C10H9ClF2O/c1-5(2)10(14)6-3-9(13)7(11)4-8(6)12/h3-4,14H,1-2H3 |
| InChIKey | NZFDNJHYWISMNK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.63 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|