C9H8ClF2NO — CID 84787100
1-(4-chloro-2,5-difluorophenyl)-2-(methylamino)ethanone (PubChem CID 84787100) has the molecular formula C9H8ClF2NO and a molecular weight of 219.62 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(methylamino)ethanone.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 84787100 |
| Molecular Formula | C9H8ClF2NO |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(methylamino)ethanone |
| SMILES | CNCC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C9H8ClF2NO/c1-13-4-9(14)5-2-8(12)6(10)3-7(5)11/h2-3,13H,4H2,1H3 |
| InChIKey | AOYIDLVKDQAAFM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|