C9H7ClF3NO — CID 117108354
1-(4-chloro-2,3,5-trifluorophenyl)-2-(methylamino)ethanone (PubChem CID 117108354) has the molecular formula C9H7ClF3NO and a molecular weight of 237.61 g/mol. Its IUPAC name is 1-(4-chloro-2,3,5-trifluorophenyl)-2-(methylamino)ethanone.
| Compound Name | 1-(4-chloro-2,3,5-trifluorophenyl)-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 117108354 |
| Molecular Formula | C9H7ClF3NO |
| Molecular Weight | 237.61 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 1-(4-chloro-2,3,5-trifluorophenyl)-2-(methylamino)ethanone |
| SMILES | CNCC(=O)c1cc(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C9H7ClF3NO/c1-14-3-6(15)4-2-5(11)7(10)9(13)8(4)12/h2,14H,3H2,1H3 |
| InChIKey | NLKVDPDZOPQZLX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|