C8H5ClF3NO — CID 117115593
2-amino-1-(3-chloro-2,4,5-trifluorophenyl)ethanone (PubChem CID 117115593) has the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. Its IUPAC name is 2-amino-1-(3-chloro-2,4,5-trifluorophenyl)ethanone.
| Compound Name | 2-amino-1-(3-chloro-2,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 117115593 |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.58 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 2-amino-1-(3-chloro-2,4,5-trifluorophenyl)ethanone |
| SMILES | NCC(=O)c1cc(F)c(F)c(Cl)c1F |
| InChI | InChI=1S/C8H5ClF3NO/c9-6-7(11)3(5(14)2-13)1-4(10)8(6)12/h1H,2,13H2 |
| InChIKey | MUOQOMPBRGMQDH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|