C8H6F3NO2 — CID 117115595
2-amino-1-(2,4,5-trifluoro-3-hydroxyphenyl)ethanone (PubChem CID 117115595) has the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. Its IUPAC name is 2-amino-1-(2,4,5-trifluoro-3-hydroxyphenyl)ethanone.
| Compound Name | 2-amino-1-(2,4,5-trifluoro-3-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 117115595 |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-amino-1-(2,4,5-trifluoro-3-hydroxyphenyl)ethanone |
| SMILES | NCC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C8H6F3NO2/c9-4-1-3(5(13)2-12)6(10)8(14)7(4)11/h1,14H,2,12H2 |
| InChIKey | DPLUMSAEPPXWSV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|