C10H9F3N2O2 — CID 63755273
(3-aminoazetidin-1-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone (PubChem CID 63755273) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is (3-aminoazetidin-1-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone.
| Compound Name | (3-aminoazetidin-1-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 63755273 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (3-aminoazetidin-1-yl)-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
| SMILES | NC1CN(C(=O)c2cc(F)c(F)c(O)c2F)C1 |
| InChI | InChI=1S/C10H9F3N2O2/c11-6-1-5(7(12)9(16)8(6)13)10(17)15-2-4(14)3-15/h1,4,16H,2-3,14H2 |
| InChIKey | MOLSMDYZEUEQTD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|