C12H9F3N2O3 — CID 79674344
4-(2,4,5-trifluoro-3-hydroxybenzoyl)morpholine-2-carbonitrile (PubChem CID 79674344) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 4-(2,4,5-trifluoro-3-hydroxybenzoyl)morpholine-2-carbonitrile.
| Compound Name | 4-(2,4,5-trifluoro-3-hydroxybenzoyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 79674344 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-(2,4,5-trifluoro-3-hydroxybenzoyl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(C(=O)c2cc(F)c(F)c(O)c2F)CCO1 |
| InChI | InChI=1S/C12H9F3N2O3/c13-8-3-7(9(14)11(18)10(8)15)12(19)17-1-2-20-6(4-16)5-17/h3,6,18H,1-2,5H2 |
| InChIKey | TYJYGWFYIOUNOB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|