C14H17N3O4 — CID 79662458
4-(2-amino-4,5-dimethoxybenzoyl)morpholine-2-carbonitrile (PubChem CID 79662458) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-(2-amino-4,5-dimethoxybenzoyl)morpholine-2-carbonitrile.
| Compound Name | 4-(2-amino-4,5-dimethoxybenzoyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 79662458 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-(2-amino-4,5-dimethoxybenzoyl)morpholine-2-carbonitrile |
| SMILES | COc1cc(N)c(C(=O)N2CCOC(C#N)C2)cc1OC |
| InChI | InChI=1S/C14H17N3O4/c1-19-12-5-10(11(16)6-13(12)20-2)14(18)17-3-4-21-9(7-15)8-17/h5-6,9H,3-4,8,16H2,1-2H3 |
| InChIKey | WLHKODHIWIALHX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|