C14H18N2O5 — CID 153370009
[5-amino-4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-2-methoxyphenyl] acetate (PubChem CID 153370009) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is [5-amino-4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-2-methoxyphenyl] acetate.
| Compound Name | [5-amino-4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 153370009 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [5-amino-4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C(=O)N2CC[C@@H](O)C2)c(N)cc1OC(C)=O |
| InChI | InChI=1S/C14H18N2O5/c1-8(17)21-13-6-11(15)10(5-12(13)20-2)14(19)16-4-3-9(18)7-16/h5-6,9,18H,3-4,7,15H2,1-2H3/t9-/m1/s1 |
| InChIKey | MPPYCFWIARZRIL-SECBINFHSA-N |
| XLogP | 0.41 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|