C16H17ClN2O3 — CID 111561895
(5-chloro-2-methoxy-4-pyrrol-1-ylphenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 111561895) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is (5-chloro-2-methoxy-4-pyrrol-1-ylphenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (5-chloro-2-methoxy-4-pyrrol-1-ylphenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 111561895 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (5-chloro-2-methoxy-4-pyrrol-1-ylphenyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | COc1cc(-n2cccc2)c(Cl)cc1C(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C16H17ClN2O3/c1-22-15-9-14(18-5-2-3-6-18)13(17)8-12(15)16(21)19-7-4-11(20)10-19/h2-3,5-6,8-9,11,20H,4,7,10H2,1H3/t11-/m1/s1 |
| InChIKey | ONVMSTPISBCDGI-LLVKDONJSA-N |
| XLogP | 2.35 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |