C14H16ClN5O3 — CID 131960710
[5-chloro-2-methoxy-4-(tetrazol-1-yl)phenyl]-(2-methylmorpholin-4-yl)methanone (PubChem CID 131960710) has the molecular formula C14H16ClN5O3 and a molecular weight of 337.77 g/mol. Its IUPAC name is [5-chloro-2-methoxy-4-(tetrazol-1-yl)phenyl]-(2-methylmorpholin-4-yl)methanone.
| Compound Name | [5-chloro-2-methoxy-4-(tetrazol-1-yl)phenyl]-(2-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 131960710 |
| Molecular Formula | C14H16ClN5O3 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [5-chloro-2-methoxy-4-(tetrazol-1-yl)phenyl]-(2-methylmorpholin-4-yl)methanone |
| SMILES | COc1cc(-n2cnnn2)c(Cl)cc1C(=O)N1CCOC(C)C1 |
| InChI | InChI=1S/C14H16ClN5O3/c1-9-7-19(3-4-23-9)14(21)10-5-11(15)12(6-13(10)22-2)20-8-16-17-18-20/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | NQCYHTJVKLHERH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |