C18H21ClN6O3 — CID 56512126
[4-[5-chloro-2-methoxy-4-(tetrazol-1-yl)benzoyl]piperazin-1-yl]-cyclobutylmethanone (PubChem CID 56512126) has the molecular formula C18H21ClN6O3 and a molecular weight of 404.86 g/mol. Its IUPAC name is [4-[5-chloro-2-methoxy-4-(tetrazol-1-yl)benzoyl]piperazin-1-yl]-cyclobutylmethanone.
| Compound Name | [4-[5-chloro-2-methoxy-4-(tetrazol-1-yl)benzoyl]piperazin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 56512126 |
| Molecular Formula | C18H21ClN6O3 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [4-[5-chloro-2-methoxy-4-(tetrazol-1-yl)benzoyl]piperazin-1-yl]-cyclobutylmethanone |
| SMILES | COc1cc(-n2cnnn2)c(Cl)cc1C(=O)N1CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C18H21ClN6O3/c1-28-16-10-15(25-11-20-21-22-25)14(19)9-13(16)18(27)24-7-5-23(6-8-24)17(26)12-3-2-4-12/h9-12H,2-8H2,1H3 |
| InChIKey | WISGSQBRXPCLHA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |