C13H14ClIN2O4 — CID 60607210
4-(5-chloro-4-iodo-2-methoxybenzoyl)morpholine-2-carboxamide (PubChem CID 60607210) has the molecular formula C13H14ClIN2O4 and a molecular weight of 424.62 g/mol. Its IUPAC name is 4-(5-chloro-4-iodo-2-methoxybenzoyl)morpholine-2-carboxamide.
| Compound Name | 4-(5-chloro-4-iodo-2-methoxybenzoyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 60607210 |
| Molecular Formula | C13H14ClIN2O4 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 4-(5-chloro-4-iodo-2-methoxybenzoyl)morpholine-2-carboxamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)N1CCOC(C(N)=O)C1 |
| InChI | InChI=1S/C13H14ClIN2O4/c1-20-10-5-9(15)8(14)4-7(10)13(19)17-2-3-21-11(6-17)12(16)18/h4-5,11H,2-3,6H2,1H3,(H2,16,18) |
| InChIKey | XSYSCHQBJZSUJH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|