C14H19ClIN3O4S — CID 46412003
4-(5-chloro-4-iodo-2-methoxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 46412003) has the molecular formula C14H19ClIN3O4S and a molecular weight of 487.75 g/mol. Its IUPAC name is 4-(5-chloro-4-iodo-2-methoxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-(5-chloro-4-iodo-2-methoxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 46412003 |
| Molecular Formula | C14H19ClIN3O4S |
| Molecular Weight | 487.75 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | 4-(5-chloro-4-iodo-2-methoxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)N1CCN(S(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C14H19ClIN3O4S/c1-17(2)24(21,22)19-6-4-18(5-7-19)14(20)10-8-11(15)12(16)9-13(10)23-3/h8-9H,4-7H2,1-3H3 |
| InChIKey | BCNWTUNRPZNKNR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|