C12H17ClN4O3S — CID 33006202
4-(2-chloropyridine-3-carbonyl)-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 33006202) has the molecular formula C12H17ClN4O3S and a molecular weight of 332.81 g/mol. Its IUPAC name is 4-(2-chloropyridine-3-carbonyl)-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-(2-chloropyridine-3-carbonyl)-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 33006202 |
| Molecular Formula | C12H17ClN4O3S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4-(2-chloropyridine-3-carbonyl)-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C12H17ClN4O3S/c1-15(2)21(19,20)17-8-6-16(7-9-17)12(18)10-4-3-5-14-11(10)13/h3-5H,6-9H2,1-2H3 |
| InChIKey | HEVLYFGUNKAHCU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|