C10H11ClN2O3 — CID 106668646
(2-chloro-3-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone (PubChem CID 106668646) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone.
| Compound Name | (2-chloro-3-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106668646 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2-chloro-3-pyridinyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cccnc1Cl)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H11ClN2O3/c11-9-6(2-1-3-12-9)10(16)13-4-7(14)8(15)5-13/h1-3,7-8,14-15H,4-5H2 |
| InChIKey | YMOUWEWVWJNZAQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|