C11H13ClN2O — CID 61226414
(2-chloro-3-pyridinyl)-(3-methylpyrrolidin-1-yl)methanone (PubChem CID 61226414) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-(3-methylpyrrolidin-1-yl)methanone.
| Compound Name | (2-chloro-3-pyridinyl)-(3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 61226414 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (2-chloro-3-pyridinyl)-(3-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2cccnc2Cl)C1 |
| InChI | InChI=1S/C11H13ClN2O/c1-8-4-6-14(7-8)11(15)9-3-2-5-13-10(9)12/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | MFVIRLRQVVIYPW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|