C10H13Cl2N3O — CID 71644269
(3-aminopyrrolidin-1-yl)-(2-chloro-3-pyridinyl)methanone;hydrochloride (PubChem CID 71644269) has the molecular formula C10H13Cl2N3O and a molecular weight of 262.14 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(2-chloro-3-pyridinyl)methanone;hydrochloride.
| Compound Name | (3-aminopyrrolidin-1-yl)-(2-chloro-3-pyridinyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 71644269 |
| Molecular Formula | C10H13Cl2N3O |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(2-chloro-3-pyridinyl)methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2cccnc2Cl)C1 |
| InChI | InChI=1S/C10H12ClN3O.ClH/c11-9-8(2-1-4-13-9)10(15)14-5-3-7(12)6-14;/h1-2,4,7H,3,5-6,12H2;1H |
| InChIKey | LPNSOBQLFLERGI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|