C11H17Cl2N3O — CID 119482706
(3-aminopyrrolidin-1-yl)-(3-methyl-2-pyridinyl)methanone;dihydrochloride (PubChem CID 119482706) has the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(3-methyl-2-pyridinyl)methanone;dihydrochloride.
| Compound Name | (3-aminopyrrolidin-1-yl)-(3-methyl-2-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119482706 |
| Molecular Formula | C11H17Cl2N3O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(3-methyl-2-pyridinyl)methanone;dihydrochloride |
| SMILES | Cc1cccnc1C(=O)N1CCC(N)C1.Cl.Cl |
| InChI | InChI=1S/C11H15N3O.2ClH/c1-8-3-2-5-13-10(8)11(15)14-6-4-9(12)7-14;;/h2-3,5,9H,4,6-7,12H2,1H3;2*1H |
| InChIKey | XDBWDYSPNIZXPJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |