C11H14Cl2N2O — CID 119934556
[(3S)-3-aminopyrrolidin-1-yl]-(2-chlorophenyl)methanone;hydrochloride (PubChem CID 119934556) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is [(3S)-3-aminopyrrolidin-1-yl]-(2-chlorophenyl)methanone;hydrochloride.
| Compound Name | [(3S)-3-aminopyrrolidin-1-yl]-(2-chlorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119934556 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | [(3S)-3-aminopyrrolidin-1-yl]-(2-chlorophenyl)methanone;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(C(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C11H13ClN2O.ClH/c12-10-4-2-1-3-9(10)11(15)14-6-5-8(13)7-14;/h1-4,8H,5-7,13H2;1H/t8-;/m0./s1 |
| InChIKey | RIBRQDATUNZYLS-QRPNPIFTSA-N |
| XLogP | 1.93 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |