C9H9ClN2OS — CID 150421157
(2-chloro-3-pyridinyl)-(1,3-thiazolidin-3-yl)methanone (PubChem CID 150421157) has the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-(1,3-thiazolidin-3-yl)methanone.
| Compound Name | (2-chloro-3-pyridinyl)-(1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 150421157 |
| Molecular Formula | C9H9ClN2OS |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (2-chloro-3-pyridinyl)-(1,3-thiazolidin-3-yl)methanone |
| SMILES | O=C(c1cccnc1Cl)N1CCSC1 |
| InChI | InChI=1S/C9H9ClN2OS/c10-8-7(2-1-3-11-8)9(13)12-4-5-14-6-12/h1-3H,4-6H2 |
| InChIKey | HHURESQEXADWTL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|