C11H11ClN2O3S — CID 21255193
3-(2-chloropyridine-3-carbonyl)-1,3-thiazinane-4-carboxylic acid (PubChem CID 21255193) has the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. Its IUPAC name is 3-(2-chloropyridine-3-carbonyl)-1,3-thiazinane-4-carboxylic acid.
| Compound Name | 3-(2-chloropyridine-3-carbonyl)-1,3-thiazinane-4-carboxylic acid |
|---|---|
| PubChem CID | 21255193 |
| Molecular Formula | C11H11ClN2O3S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-(2-chloropyridine-3-carbonyl)-1,3-thiazinane-4-carboxylic acid |
| SMILES | O=C(O)C1CCSCN1C(=O)c1cccnc1Cl |
| InChI | InChI=1S/C11H11ClN2O3S/c12-9-7(2-1-4-13-9)10(15)14-6-18-5-3-8(14)11(16)17/h1-2,4,8H,3,5-6H2,(H,16,17) |
| InChIKey | ROEPMANLIVNXGE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|