C10H10ClNOS — CID 122331936
(2-chlorophenyl)-(1,3-thiazolidin-3-yl)methanone (PubChem CID 122331936) has the molecular formula C10H10ClNOS and a molecular weight of 227.72 g/mol. Its IUPAC name is (2-chlorophenyl)-(1,3-thiazolidin-3-yl)methanone.
| Compound Name | (2-chlorophenyl)-(1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 122331936 |
| Molecular Formula | C10H10ClNOS |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | (2-chlorophenyl)-(1,3-thiazolidin-3-yl)methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCSC1 |
| InChI | InChI=1S/C10H10ClNOS/c11-9-4-2-1-3-8(9)10(13)12-5-6-14-7-12/h1-4H,5-7H2 |
| InChIKey | VEGXTICFWXHBOD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |